C18H24ClN3O4 — CID 9317785
N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-N-methyl-2-(2-oxoazepan-1-yl)acetamide (PubChem CID 9317785) has the molecular formula C18H24ClN3O4 and a molecular weight of 381.86 g/mol. Its IUPAC name is N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-N-methyl-2-(2-oxoazepan-1-yl)acetamide.
| Compound Name | N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-N-methyl-2-(2-oxoazepan-1-yl)acetamide |
|---|---|
| PubChem CID | 9317785 |
| Molecular Formula | C18H24ClN3O4 |
| Molecular Weight | 381.86 g/mol |
| Exact Mass | 381.15 |
| IUPAC Name | N-[2-(5-chloro-2-methoxyanilino)-2-oxoethyl]-N-methyl-2-(2-oxoazepan-1-yl)acetamide |
| SMILES | COc1ccc(Cl)cc1NC(=O)CN(C)C(=O)CN1CCCCCC1=O |
| InChI | InChI=1S/C18H24ClN3O4/c1-21(18(25)12-22-9-5-3-4-6-17(22)24)11-16(23)20-14-10-13(19)7-8-15(14)26-2/h7-8,10H,3-6,9,11-12H2,1-2H3,(H,20,23) |
| InChIKey | XKZLDRKFSWHKOP-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.86 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |