C22H24N2O5 — CID 7888043
[2-(2-methoxy-5-methylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate (PubChem CID 7888043) has the molecular formula C22H24N2O5 and a molecular weight of 396.44 g/mol. Its IUPAC name is [2-(2-methoxy-5-methylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate.
| Compound Name | [2-(2-methoxy-5-methylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate |
|---|---|
| PubChem CID | 7888043 |
| Molecular Formula | C22H24N2O5 |
| Molecular Weight | 396.44 g/mol |
| Exact Mass | 396.17 |
| IUPAC Name | [2-(2-methoxy-5-methylanilino)-2-oxoethyl] 4-[(2-oxopyrrolidin-1-yl)methyl]benzoate |
| SMILES | COc1ccc(C)cc1NC(=O)COC(=O)c1ccc(CN2CCCC2=O)cc1 |
| InChI | InChI=1S/C22H24N2O5/c1-15-5-10-19(28-2)18(12-15)23-20(25)14-29-22(27)17-8-6-16(7-9-17)13-24-11-3-4-21(24)26/h5-10,12H,3-4,11,13-14H2,1-2H3,(H,23,25) |
| InChIKey | PRDYSEMAMQBIHE-UHFFFAOYSA-N |
| XLogP | 2.92 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.44 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |