C21H22N2O5 — CID 2127028
[2-(2-methoxy-5-methylanilino)-2-oxoethyl] 4-(2-oxopyrrolidin-1-yl)benzoate (PubChem CID 2127028) has the molecular formula C21H22N2O5 and a molecular weight of 382.42 g/mol. Its IUPAC name is [2-(2-methoxy-5-methylanilino)-2-oxoethyl] 4-(2-oxopyrrolidin-1-yl)benzoate.
| Compound Name | [2-(2-methoxy-5-methylanilino)-2-oxoethyl] 4-(2-oxopyrrolidin-1-yl)benzoate |
|---|---|
| PubChem CID | 2127028 |
| Molecular Formula | C21H22N2O5 |
| Molecular Weight | 382.42 g/mol |
| Exact Mass | 382.15 |
| IUPAC Name | [2-(2-methoxy-5-methylanilino)-2-oxoethyl] 4-(2-oxopyrrolidin-1-yl)benzoate |
| SMILES | COc1ccc(C)cc1NC(=O)COC(=O)c1ccc(N2CCCC2=O)cc1 |
| InChI | InChI=1S/C21H22N2O5/c1-14-5-10-18(27-2)17(12-14)22-19(24)13-28-21(26)15-6-8-16(9-7-15)23-11-3-4-20(23)25/h5-10,12H,3-4,11,13H2,1-2H3,(H,22,24) |
| InChIKey | QINYPQLTDKIRIX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.42 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |