C20H20ClN3O3 — CID 30755522
N'-[2-(4-chlorophenyl)acetyl]-4-[(2-oxopyrrolidin-1-yl)methyl]benzohydrazide (PubChem CID 30755522) has the molecular formula C20H20ClN3O3 and a molecular weight of 385.85 g/mol. Its IUPAC name is N'-[2-(4-chlorophenyl)acetyl]-4-[(2-oxopyrrolidin-1-yl)methyl]benzohydrazide.
| Compound Name | N'-[2-(4-chlorophenyl)acetyl]-4-[(2-oxopyrrolidin-1-yl)methyl]benzohydrazide |
|---|---|
| PubChem CID | 30755522 |
| Molecular Formula | C20H20ClN3O3 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.12 |
| IUPAC Name | N'-[2-(4-chlorophenyl)acetyl]-4-[(2-oxopyrrolidin-1-yl)methyl]benzohydrazide |
| SMILES | O=C(Cc1ccc(Cl)cc1)NNC(=O)c1ccc(CN2CCCC2=O)cc1 |
| InChI | InChI=1S/C20H20ClN3O3/c21-17-9-5-14(6-10-17)12-18(25)22-23-20(27)16-7-3-15(4-8-16)13-24-11-1-2-19(24)26/h3-10H,1-2,11-13H2,(H,22,25)(H,23,27) |
| InChIKey | UXGVJLIFVWMLRL-UHFFFAOYSA-N |
| XLogP | 2.47 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|