C14H12ClN3O4S2 — CID 8573539
N'-[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]-3-nitrobenzohydrazide (PubChem CID 8573539) has the molecular formula C14H12ClN3O4S2 and a molecular weight of 385.85 g/mol. Its IUPAC name is N'-[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]-3-nitrobenzohydrazide.
| Compound Name | N'-[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]-3-nitrobenzohydrazide |
|---|---|
| PubChem CID | 8573539 |
| Molecular Formula | C14H12ClN3O4S2 |
| Molecular Weight | 385.85 g/mol |
| Exact Mass | 385.00 |
| IUPAC Name | N'-[2-[(5-chlorothiophen-2-yl)methylsulfanyl]acetyl]-3-nitrobenzohydrazide |
| SMILES | O=C(CSCc1ccc(Cl)s1)NNC(=O)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C14H12ClN3O4S2/c15-12-5-4-11(24-12)7-23-8-13(19)16-17-14(20)9-2-1-3-10(6-9)18(21)22/h1-6H,7-8H2,(H,16,19)(H,17,20) |
| InChIKey | WPYHYISHWOOGJT-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 101.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.85 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|