C21H17ClN4O2S2 — CID 51064958
5-(4-chlorophenyl)-3-methyl-N-[5-[(2-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1,2-oxazole-4-carboxamide (PubChem CID 51064958) has the molecular formula C21H17ClN4O2S2 and a molecular weight of 456.98 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-3-methyl-N-[5-[(2-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1,2-oxazole-4-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-3-methyl-N-[5-[(2-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1,2-oxazole-4-carboxamide |
|---|---|
| PubChem CID | 51064958 |
| Molecular Formula | C21H17ClN4O2S2 |
| Molecular Weight | 456.98 g/mol |
| Exact Mass | 456.05 |
| IUPAC Name | 5-(4-chlorophenyl)-3-methyl-N-[5-[(2-methylphenyl)methylsulfanyl]-1,3,4-thiadiazol-2-yl]-1,2-oxazole-4-carboxamide |
| SMILES | Cc1ccccc1CSc1nnc(NC(=O)c2c(C)noc2-c2ccc(Cl)cc2)s1 |
| InChI | InChI=1S/C21H17ClN4O2S2/c1-12-5-3-4-6-15(12)11-29-21-25-24-20(30-21)23-19(27)17-13(2)26-28-18(17)14-7-9-16(22)10-8-14/h3-10H,11H2,1-2H3,(H,23,24,27) |
| InChIKey | TYVYYGFDVFENOR-UHFFFAOYSA-N |
| XLogP | 6.01 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.98 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|