C16H17N5O2S2 — CID 7579696
1-ethyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-methyl-2-oxoquinoxaline-6-carboxamide (PubChem CID 7579696) has the molecular formula C16H17N5O2S2 and a molecular weight of 375.48 g/mol. Its IUPAC name is 1-ethyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-methyl-2-oxoquinoxaline-6-carboxamide.
| Compound Name | 1-ethyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-methyl-2-oxoquinoxaline-6-carboxamide |
|---|---|
| PubChem CID | 7579696 |
| Molecular Formula | C16H17N5O2S2 |
| Molecular Weight | 375.48 g/mol |
| Exact Mass | 375.08 |
| IUPAC Name | 1-ethyl-N-(5-ethylsulfanyl-1,3,4-thiadiazol-2-yl)-3-methyl-2-oxoquinoxaline-6-carboxamide |
| SMILES | CCSc1nnc(NC(=O)c2ccc3c(c2)nc(C)c(=O)n3CC)s1 |
| InChI | InChI=1S/C16H17N5O2S2/c1-4-21-12-7-6-10(8-11(12)17-9(3)14(21)23)13(22)18-15-19-20-16(25-15)24-5-2/h6-8H,4-5H2,1-3H3,(H,18,19,22) |
| InChIKey | PKZAXBQUBWNDIV-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.48 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|