C23H25N5O6S3 — CID 44956578
N-[5-[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-(diethylsulfamoyl)benzamide (PubChem CID 44956578) has the molecular formula C23H25N5O6S3 and a molecular weight of 563.68 g/mol. Its IUPAC name is N-[5-[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-(diethylsulfamoyl)benzamide.
| Compound Name | N-[5-[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-(diethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 44956578 |
| Molecular Formula | C23H25N5O6S3 |
| Molecular Weight | 563.68 g/mol |
| Exact Mass | 563.10 |
| IUPAC Name | N-[5-[2-(1,3-benzodioxol-5-ylmethylamino)-2-oxoethyl]sulfanyl-1,3,4-thiadiazol-2-yl]-4-(diethylsulfamoyl)benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(C(=O)Nc2nnc(SCC(=O)NCc3ccc4c(c3)OCO4)s2)cc1 |
| InChI | InChI=1S/C23H25N5O6S3/c1-3-28(4-2)37(31,32)17-8-6-16(7-9-17)21(30)25-22-26-27-23(36-22)35-13-20(29)24-12-15-5-10-18-19(11-15)34-14-33-18/h5-11H,3-4,12-14H2,1-2H3,(H,24,29)(H,25,26,30) |
| InChIKey | IYHIZRUPNIZXEE-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 139.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.68 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'N-acyl-2-amino-5-mercapto-1,3,4-_thiadiazole', 'substructure': 'N/A'} |
|---|