C11H16N4O3S3 — CID 7797486
N-[(3S)-1,1-dioxothiolan-3-yl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide (PubChem CID 7797486) has the molecular formula C11H16N4O3S3 and a molecular weight of 348.48 g/mol. Its IUPAC name is N-[(3S)-1,1-dioxothiolan-3-yl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide.
| Compound Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 7797486 |
| Molecular Formula | C11H16N4O3S3 |
| Molecular Weight | 348.48 g/mol |
| Exact Mass | 348.04 |
| IUPAC Name | N-[(3S)-1,1-dioxothiolan-3-yl]-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]acetamide |
| SMILES | C=CCNc1nnc(SCC(=O)N[C@H]2CCS(=O)(=O)C2)s1 |
| InChI | InChI=1S/C11H16N4O3S3/c1-2-4-12-10-14-15-11(20-10)19-6-9(16)13-8-3-5-21(17,18)7-8/h2,8H,1,3-7H2,(H,12,14)(H,13,16)/t8-/m0/s1 |
| InChIKey | BZJHKDDDTZMDJD-QMMMGPOBSA-N |
| XLogP | 0.53 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.48 |
| LogP ≤ 5 | 0.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|