C18H24N5OS2+ — CID 7798402
1-(4-benzylpiperazin-4-ium-1-yl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone (PubChem CID 7798402) has the molecular formula C18H24N5OS2+ and a molecular weight of 390.56 g/mol. Its IUPAC name is 1-(4-benzylpiperazin-4-ium-1-yl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone.
| Compound Name | 1-(4-benzylpiperazin-4-ium-1-yl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 7798402 |
| Molecular Formula | C18H24N5OS2+ |
| Molecular Weight | 390.56 g/mol |
| Exact Mass | 390.14 |
| IUPAC Name | 1-(4-benzylpiperazin-4-ium-1-yl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone |
| SMILES | C=CCNc1nnc(SCC(=O)N2CC[NH+](Cc3ccccc3)CC2)s1 |
| InChI | InChI=1S/C18H23N5OS2/c1-2-8-19-17-20-21-18(26-17)25-14-16(24)23-11-9-22(10-12-23)13-15-6-4-3-5-7-15/h2-7H,1,8-14H2,(H,19,20)/p+1 |
| InChIKey | BVSVBDKYNUBFLG-UHFFFAOYSA-O |
| XLogP | 1.16 |
| TPSA | 62.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.56 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|