C13H11F2N3OS2 — CID 7797556
1-(2,5-difluorophenyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone (PubChem CID 7797556) has the molecular formula C13H11F2N3OS2 and a molecular weight of 327.38 g/mol. Its IUPAC name is 1-(2,5-difluorophenyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone.
| Compound Name | 1-(2,5-difluorophenyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 7797556 |
| Molecular Formula | C13H11F2N3OS2 |
| Molecular Weight | 327.38 g/mol |
| Exact Mass | 327.03 |
| IUPAC Name | 1-(2,5-difluorophenyl)-2-[[5-(prop-2-enylamino)-1,3,4-thiadiazol-2-yl]sulfanyl]ethanone |
| SMILES | C=CCNc1nnc(SCC(=O)c2cc(F)ccc2F)s1 |
| InChI | InChI=1S/C13H11F2N3OS2/c1-2-5-16-12-17-18-13(21-12)20-7-11(19)9-6-8(14)3-4-10(9)15/h2-4,6H,1,5,7H2,(H,16,17) |
| InChIKey | YGLOMNSICXILIC-UHFFFAOYSA-N |
| XLogP | 3.39 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.38 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|