C7H13N5OS2 — CID 79631384
3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-2,2-dimethylpropanehydrazide (PubChem CID 79631384) has the molecular formula C7H13N5OS2 and a molecular weight of 247.35 g/mol. Its IUPAC name is 3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-2,2-dimethylpropanehydrazide.
| Compound Name | 3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-2,2-dimethylpropanehydrazide |
|---|---|
| PubChem CID | 79631384 |
| Molecular Formula | C7H13N5OS2 |
| Molecular Weight | 247.35 g/mol |
| Exact Mass | 247.06 |
| IUPAC Name | 3-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]-2,2-dimethylpropanehydrazide |
| SMILES | CC(C)(CSc1nnc(N)s1)C(=O)NN |
| InChI | InChI=1S/C7H13N5OS2/c1-7(2,4(13)10-9)3-14-6-12-11-5(8)15-6/h3,9H2,1-2H3,(H2,8,11)(H,10,13) |
| InChIKey | OKLIEDQTNPMQKM-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 106.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.35 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|