C7H9N3O2S2 — CID 71670131
methyl (E)-4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enoate (PubChem CID 71670131) has the molecular formula C7H9N3O2S2 and a molecular weight of 231.30 g/mol. Its IUPAC name is methyl (E)-4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enoate.
| Compound Name | methyl (E)-4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enoate |
|---|---|
| PubChem CID | 71670131 |
| Molecular Formula | C7H9N3O2S2 |
| Molecular Weight | 231.30 g/mol |
| Exact Mass | 231.01 |
| IUPAC Name | methyl (E)-4-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enoate |
| SMILES | COC(=O)/C=C/CSc1nnc(N)s1 |
| InChI | InChI=1S/C7H9N3O2S2/c1-12-5(11)3-2-4-13-7-10-9-6(8)14-7/h2-3H,4H2,1H3,(H2,8,9)/b3-2+ |
| InChIKey | WYAUDJGEVZXRAA-NSCUHMNNSA-N |
| XLogP | 0.94 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.30 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|