C8H10N2O2S2 — CID 70598301
methyl 4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enoate (PubChem CID 70598301) has the molecular formula C8H10N2O2S2 and a molecular weight of 230.31 g/mol. Its IUPAC name is methyl 4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enoate.
| Compound Name | methyl 4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enoate |
|---|---|
| PubChem CID | 70598301 |
| Molecular Formula | C8H10N2O2S2 |
| Molecular Weight | 230.31 g/mol |
| Exact Mass | 230.02 |
| IUPAC Name | methyl 4-[(5-methyl-1,3,4-thiadiazol-2-yl)sulfanyl]but-2-enoate |
| SMILES | COC(=O)C=CCSc1nnc(C)s1 |
| InChI | InChI=1S/C8H10N2O2S2/c1-6-9-10-8(14-6)13-5-3-4-7(11)12-2/h3-4H,5H2,1-2H3 |
| InChIKey | NNMRYLDNZRHQNI-UHFFFAOYSA-N |
| XLogP | 1.67 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.31 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|