C11H14N4O2S3 — CID 2197756
N-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-4-methylbenzenesulfonamide (PubChem CID 2197756) has the molecular formula C11H14N4O2S3 and a molecular weight of 330.46 g/mol. Its IUPAC name is N-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-4-methylbenzenesulfonamide.
| Compound Name | N-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 2197756 |
| Molecular Formula | C11H14N4O2S3 |
| Molecular Weight | 330.46 g/mol |
| Exact Mass | 330.03 |
| IUPAC Name | N-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]ethyl]-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NCCSc2nnc(N)s2)cc1 |
| InChI | InChI=1S/C11H14N4O2S3/c1-8-2-4-9(5-3-8)20(16,17)13-6-7-18-11-15-14-10(12)19-11/h2-5,13H,6-7H2,1H3,(H2,12,14) |
| InChIKey | YTOBFBYLIUUKFV-UHFFFAOYSA-N |
| XLogP | 1.50 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.46 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|