C4H4N4S2 — CID 20623947
5-(isocyanomethylsulfanyl)-1,3,4-thiadiazol-2-amine (PubChem CID 20623947) has the molecular formula C4H4N4S2 and a molecular weight of 172.24 g/mol. Its IUPAC name is 5-(isocyanomethylsulfanyl)-1,3,4-thiadiazol-2-amine.
| Compound Name | 5-(isocyanomethylsulfanyl)-1,3,4-thiadiazol-2-amine |
|---|---|
| PubChem CID | 20623947 |
| Molecular Formula | C4H4N4S2 |
| Molecular Weight | 172.24 g/mol |
| Exact Mass | 171.99 |
| IUPAC Name | 5-(isocyanomethylsulfanyl)-1,3,4-thiadiazol-2-amine |
| SMILES | [C-]#[N+]CSc1nnc(N)s1 |
| InChI | InChI=1S/C4H4N4S2/c1-6-2-9-4-8-7-3(5)10-4/h2H2,(H2,5,7) |
| InChIKey | XEAWNFWKSGMHDK-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 56.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.24 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|