C21H24N2O6S — CID 16536541
2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazole (PubChem CID 16536541) has the molecular formula C21H24N2O6S and a molecular weight of 432.50 g/mol. Its IUPAC name is 2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 16536541 |
| Molecular Formula | C21H24N2O6S |
| Molecular Weight | 432.50 g/mol |
| Exact Mass | 432.14 |
| IUPAC Name | 2-[2-(4-ethoxyphenoxy)ethylsulfanyl]-5-(3,4,5-trimethoxyphenyl)-1,3,4-oxadiazole |
| SMILES | CCOc1ccc(OCCSc2nnc(-c3cc(OC)c(OC)c(OC)c3)o2)cc1 |
| InChI | InChI=1S/C21H24N2O6S/c1-5-27-15-6-8-16(9-7-15)28-10-11-30-21-23-22-20(29-21)14-12-17(24-2)19(26-4)18(13-14)25-3/h6-9,12-13H,5,10-11H2,1-4H3 |
| InChIKey | BZSCNLIHRZILAM-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 85.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.50 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|