C20H22N2O4S — CID 112780389
2-(3,4-dimethoxyphenyl)-5-[2-(3-ethylphenoxy)ethylsulfanyl]-1,3,4-oxadiazole (PubChem CID 112780389) has the molecular formula C20H22N2O4S and a molecular weight of 386.47 g/mol. Its IUPAC name is 2-(3,4-dimethoxyphenyl)-5-[2-(3-ethylphenoxy)ethylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-(3,4-dimethoxyphenyl)-5-[2-(3-ethylphenoxy)ethylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 112780389 |
| Molecular Formula | C20H22N2O4S |
| Molecular Weight | 386.47 g/mol |
| Exact Mass | 386.13 |
| IUPAC Name | 2-(3,4-dimethoxyphenyl)-5-[2-(3-ethylphenoxy)ethylsulfanyl]-1,3,4-oxadiazole |
| SMILES | CCc1cccc(OCCSc2nnc(-c3ccc(OC)c(OC)c3)o2)c1 |
| InChI | InChI=1S/C20H22N2O4S/c1-4-14-6-5-7-16(12-14)25-10-11-27-20-22-21-19(26-20)15-8-9-17(23-2)18(13-15)24-3/h5-9,12-13H,4,10-11H2,1-3H3 |
| InChIKey | AKJKVKSHKRKHBA-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 66.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.47 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|