C19H19ClN2O3S — CID 112785968
2-[(4-chlorophenoxy)methyl]-5-[2-(3-ethylphenoxy)ethylsulfanyl]-1,3,4-oxadiazole (PubChem CID 112785968) has the molecular formula C19H19ClN2O3S and a molecular weight of 390.89 g/mol. Its IUPAC name is 2-[(4-chlorophenoxy)methyl]-5-[2-(3-ethylphenoxy)ethylsulfanyl]-1,3,4-oxadiazole.
| Compound Name | 2-[(4-chlorophenoxy)methyl]-5-[2-(3-ethylphenoxy)ethylsulfanyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 112785968 |
| Molecular Formula | C19H19ClN2O3S |
| Molecular Weight | 390.89 g/mol |
| Exact Mass | 390.08 |
| IUPAC Name | 2-[(4-chlorophenoxy)methyl]-5-[2-(3-ethylphenoxy)ethylsulfanyl]-1,3,4-oxadiazole |
| SMILES | CCc1cccc(OCCSc2nnc(COc3ccc(Cl)cc3)o2)c1 |
| InChI | InChI=1S/C19H19ClN2O3S/c1-2-14-4-3-5-17(12-14)23-10-11-26-19-22-21-18(25-19)13-24-16-8-6-15(20)7-9-16/h3-9,12H,2,10-11,13H2,1H3 |
| InChIKey | NSGDAFFDWCZZGS-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.89 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|