C14H14ClN3O2S — CID 112785931
5-[[5-[(4-chlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]pentanenitrile (PubChem CID 112785931) has the molecular formula C14H14ClN3O2S and a molecular weight of 323.81 g/mol. Its IUPAC name is 5-[[5-[(4-chlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]pentanenitrile.
| Compound Name | 5-[[5-[(4-chlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]pentanenitrile |
|---|---|
| PubChem CID | 112785931 |
| Molecular Formula | C14H14ClN3O2S |
| Molecular Weight | 323.81 g/mol |
| Exact Mass | 323.05 |
| IUPAC Name | 5-[[5-[(4-chlorophenoxy)methyl]-1,3,4-oxadiazol-2-yl]sulfanyl]pentanenitrile |
| SMILES | N#CCCCCSc1nnc(COc2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C14H14ClN3O2S/c15-11-4-6-12(7-5-11)19-10-13-17-18-14(20-13)21-9-3-1-2-8-16/h4-7H,1-3,9-10H2 |
| InChIKey | JTHHQOKSCLSPAL-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 71.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.81 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|