C18H17FN2O3S — CID 84602481
2-[2-(2-fluorophenoxy)ethylsulfanyl]-5-[(3-methylphenoxy)methyl]-1,3,4-oxadiazole (PubChem CID 84602481) has the molecular formula C18H17FN2O3S and a molecular weight of 360.41 g/mol. Its IUPAC name is 2-[2-(2-fluorophenoxy)ethylsulfanyl]-5-[(3-methylphenoxy)methyl]-1,3,4-oxadiazole.
| Compound Name | 2-[2-(2-fluorophenoxy)ethylsulfanyl]-5-[(3-methylphenoxy)methyl]-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 84602481 |
| Molecular Formula | C18H17FN2O3S |
| Molecular Weight | 360.41 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | 2-[2-(2-fluorophenoxy)ethylsulfanyl]-5-[(3-methylphenoxy)methyl]-1,3,4-oxadiazole |
| SMILES | Cc1cccc(OCc2nnc(SCCOc3ccccc3F)o2)c1 |
| InChI | InChI=1S/C18H17FN2O3S/c1-13-5-4-6-14(11-13)23-12-17-20-21-18(24-17)25-10-9-22-16-8-3-2-7-15(16)19/h2-8,11H,9-10,12H2,1H3 |
| InChIKey | FULSOPIJLCMXRK-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.41 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|