C14H12N2O4S3 — CID 38924145
phenyl 2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethanesulfonate (PubChem CID 38924145) has the molecular formula C14H12N2O4S3 and a molecular weight of 368.46 g/mol. Its IUPAC name is phenyl 2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethanesulfonate.
| Compound Name | phenyl 2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethanesulfonate |
|---|---|
| PubChem CID | 38924145 |
| Molecular Formula | C14H12N2O4S3 |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.00 |
| IUPAC Name | phenyl 2-[(5-thiophen-2-yl-1,3,4-oxadiazol-2-yl)sulfanyl]ethanesulfonate |
| SMILES | O=S(=O)(CCSc1nnc(-c2cccs2)o1)Oc1ccccc1 |
| InChI | InChI=1S/C14H12N2O4S3/c17-23(18,20-11-5-2-1-3-6-11)10-9-22-14-16-15-13(19-14)12-7-4-8-21-12/h1-8H,9-10H2 |
| InChIKey | ZMCWAKMQAOQZAH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 82.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|