C15H10FIN2OS — CID 19060788
2-[(4-fluorophenyl)methylsulfanyl]-5-(4-iodophenyl)-1,3,4-oxadiazole (PubChem CID 19060788) has the molecular formula C15H10FIN2OS and a molecular weight of 412.23 g/mol. Its IUPAC name is 2-[(4-fluorophenyl)methylsulfanyl]-5-(4-iodophenyl)-1,3,4-oxadiazole.
| Compound Name | 2-[(4-fluorophenyl)methylsulfanyl]-5-(4-iodophenyl)-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 19060788 |
| Molecular Formula | C15H10FIN2OS |
| Molecular Weight | 412.23 g/mol |
| Exact Mass | 411.95 |
| IUPAC Name | 2-[(4-fluorophenyl)methylsulfanyl]-5-(4-iodophenyl)-1,3,4-oxadiazole |
| SMILES | Fc1ccc(CSc2nnc(-c3ccc(I)cc3)o2)cc1 |
| InChI | InChI=1S/C15H10FIN2OS/c16-12-5-1-10(2-6-12)9-21-15-19-18-14(20-15)11-3-7-13(17)8-4-11/h1-8H,9H2 |
| InChIKey | VTTUFKXEYBEVFT-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 38.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.23 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|