C12H11N2O3S- — CID 8708400
4-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzoate (PubChem CID 8708400) has the molecular formula C12H11N2O3S- and a molecular weight of 263.30 g/mol. Its IUPAC name is 4-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzoate.
| Compound Name | 4-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzoate |
|---|---|
| PubChem CID | 8708400 |
| Molecular Formula | C12H11N2O3S- |
| Molecular Weight | 263.30 g/mol |
| Exact Mass | 263.05 |
| IUPAC Name | 4-[(5-ethyl-1,3,4-oxadiazol-2-yl)sulfanylmethyl]benzoate |
| SMILES | CCc1nnc(SCc2ccc(C(=O)[O-])cc2)o1 |
| InChI | InChI=1S/C12H12N2O3S/c1-2-10-13-14-12(17-10)18-7-8-3-5-9(6-4-8)11(15)16/h3-6H,2,7H2,1H3,(H,15,16)/p-1 |
| InChIKey | YBTICIYOJALYBI-UHFFFAOYSA-M |
| XLogP | 1.29 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.30 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |