C10H15ClN6O2 — CID 155147487
aminourea;5-(4-methylphenyl)-1,3,4-oxadiazol-2-amine;hydrochloride (PubChem CID 155147487) has the molecular formula C10H15ClN6O2 and a molecular weight of 286.72 g/mol. Its IUPAC name is aminourea;5-(4-methylphenyl)-1,3,4-oxadiazol-2-amine;hydrochloride.
| Compound Name | aminourea;5-(4-methylphenyl)-1,3,4-oxadiazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 155147487 |
| Molecular Formula | C10H15ClN6O2 |
| Molecular Weight | 286.72 g/mol |
| Exact Mass | 286.09 |
| IUPAC Name | aminourea;5-(4-methylphenyl)-1,3,4-oxadiazol-2-amine;hydrochloride |
| SMILES | Cc1ccc(-c2nnc(N)o2)cc1.Cl.NNC(N)=O |
| InChI | InChI=1S/C9H9N3O.CH5N3O.ClH/c1-6-2-4-7(5-3-6)8-11-12-9(10)13-8;2-1(5)4-3;/h2-5H,1H3,(H2,10,12);3H2,(H3,2,4,5);1H |
| InChIKey | IXMSMXGPYVLNFG-UHFFFAOYSA-N |
| XLogP | 0.58 |
| TPSA | 146.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.72 |
| LogP ≤ 5 | 0.58 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|