C25H28N4O2S — CID 142392077
3-[2-(cyclopropylamino)-1,3-thiazol-4-yl]-N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]benzamide (PubChem CID 142392077) has the molecular formula C25H28N4O2S and a molecular weight of 448.59 g/mol. Its IUPAC name is 3-[2-(cyclopropylamino)-1,3-thiazol-4-yl]-N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]benzamide.
| Compound Name | 3-[2-(cyclopropylamino)-1,3-thiazol-4-yl]-N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]benzamide |
|---|---|
| PubChem CID | 142392077 |
| Molecular Formula | C25H28N4O2S |
| Molecular Weight | 448.59 g/mol |
| Exact Mass | 448.19 |
| IUPAC Name | 3-[2-(cyclopropylamino)-1,3-thiazol-4-yl]-N-[4-[(2R,6S)-2,6-dimethylmorpholin-4-yl]phenyl]benzamide |
| SMILES | C[C@@H]1CN(c2ccc(NC(=O)c3cccc(-c4csc(NC5CC5)n4)c3)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C25H28N4O2S/c1-16-13-29(14-17(2)31-16)22-10-8-20(9-11-22)26-24(30)19-5-3-4-18(12-19)23-15-32-25(28-23)27-21-6-7-21/h3-5,8-12,15-17,21H,6-7,13-14H2,1-2H3,(H,26,30)(H,27,28)/t16-,17+ |
| InChIKey | UIGXHRHKVCKDJR-CALCHBBNSA-N |
| XLogP | 5.25 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.59 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|