C19H21N5O2 — CID 52512892
N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-2H-benzotriazole-5-carboxamide (PubChem CID 52512892) has the molecular formula C19H21N5O2 and a molecular weight of 351.41 g/mol. Its IUPAC name is N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-2H-benzotriazole-5-carboxamide.
| Compound Name | N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-2H-benzotriazole-5-carboxamide |
|---|---|
| PubChem CID | 52512892 |
| Molecular Formula | C19H21N5O2 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.17 |
| IUPAC Name | N-[4-[(2S,6S)-2,6-dimethylmorpholin-4-yl]phenyl]-2H-benzotriazole-5-carboxamide |
| SMILES | C[C@H]1CN(c2ccc(NC(=O)c3ccc4n[nH]nc4c3)cc2)C[C@H](C)O1 |
| InChI | InChI=1S/C19H21N5O2/c1-12-10-24(11-13(2)26-12)16-6-4-15(5-7-16)20-19(25)14-3-8-17-18(9-14)22-23-21-17/h3-9,12-13H,10-11H2,1-2H3,(H,20,25)(H,21,22,23)/t12-,13-/m0/s1 |
| InChIKey | GOPBCJRYLAZBED-STQMWFEESA-N |
| XLogP | 2.82 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|