C16H14N4O3S — CID 713343
2-methoxy-N-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)carbamothioyl]benzamide (PubChem CID 713343) has the molecular formula C16H14N4O3S and a molecular weight of 342.38 g/mol. Its IUPAC name is 2-methoxy-N-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)carbamothioyl]benzamide.
| Compound Name | 2-methoxy-N-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 713343 |
| Molecular Formula | C16H14N4O3S |
| Molecular Weight | 342.38 g/mol |
| Exact Mass | 342.08 |
| IUPAC Name | 2-methoxy-N-[(2-oxo-1,3-dihydrobenzimidazol-5-yl)carbamothioyl]benzamide |
| SMILES | COc1ccccc1C(=O)NC(=S)Nc1ccc2[nH]c(=O)[nH]c2c1 |
| InChI | InChI=1S/C16H14N4O3S/c1-23-13-5-3-2-4-10(13)14(21)20-16(24)17-9-6-7-11-12(8-9)19-15(22)18-11/h2-8H,1H3,(H2,18,19,22)(H2,17,20,21,24) |
| InChIKey | OONNOCDWXGQQOW-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 99.01 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.38 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|