C31H34N4O5S2 — CID 146421258
N-[6-(azetidin-1-ylsulfonyl)-1,3-benzothiazol-2-yl]-2-(4-morpholin-4-ylbutoxy)-4-phenylbenzamide (PubChem CID 146421258) has the molecular formula C31H34N4O5S2 and a molecular weight of 606.77 g/mol. Its IUPAC name is N-[6-(azetidin-1-ylsulfonyl)-1,3-benzothiazol-2-yl]-2-(4-morpholin-4-ylbutoxy)-4-phenylbenzamide.
| Compound Name | N-[6-(azetidin-1-ylsulfonyl)-1,3-benzothiazol-2-yl]-2-(4-morpholin-4-ylbutoxy)-4-phenylbenzamide |
|---|---|
| PubChem CID | 146421258 |
| Molecular Formula | C31H34N4O5S2 |
| Molecular Weight | 606.77 g/mol |
| Exact Mass | 606.20 |
| IUPAC Name | N-[6-(azetidin-1-ylsulfonyl)-1,3-benzothiazol-2-yl]-2-(4-morpholin-4-ylbutoxy)-4-phenylbenzamide |
| SMILES | O=C(Nc1nc2ccc(S(=O)(=O)N3CCC3)cc2s1)c1ccc(-c2ccccc2)cc1OCCCCN1CCOCC1 |
| InChI | InChI=1S/C31H34N4O5S2/c36-30(33-31-32-27-12-10-25(22-29(27)41-31)42(37,38)35-14-6-15-35)26-11-9-24(23-7-2-1-3-8-23)21-28(26)40-18-5-4-13-34-16-19-39-20-17-34/h1-3,7-12,21-22H,4-6,13-20H2,(H,32,33,36) |
| InChIKey | JXHSPISVYJBWGT-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 101.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.77 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|