C27H30N4O5S2 — CID 146346198
N-[6-(methanesulfonamido)-1,3-benzothiazol-2-yl]-3-(4-morpholin-4-ylbutoxy)naphthalene-2-carboxamide (PubChem CID 146346198) has the molecular formula C27H30N4O5S2 and a molecular weight of 554.69 g/mol. Its IUPAC name is N-[6-(methanesulfonamido)-1,3-benzothiazol-2-yl]-3-(4-morpholin-4-ylbutoxy)naphthalene-2-carboxamide.
| Compound Name | N-[6-(methanesulfonamido)-1,3-benzothiazol-2-yl]-3-(4-morpholin-4-ylbutoxy)naphthalene-2-carboxamide |
|---|---|
| PubChem CID | 146346198 |
| Molecular Formula | C27H30N4O5S2 |
| Molecular Weight | 554.69 g/mol |
| Exact Mass | 554.17 |
| IUPAC Name | N-[6-(methanesulfonamido)-1,3-benzothiazol-2-yl]-3-(4-morpholin-4-ylbutoxy)naphthalene-2-carboxamide |
| SMILES | CS(=O)(=O)Nc1ccc2nc(NC(=O)c3cc4ccccc4cc3OCCCCN3CCOCC3)sc2c1 |
| InChI | InChI=1S/C27H30N4O5S2/c1-38(33,34)30-21-8-9-23-25(18-21)37-27(28-23)29-26(32)22-16-19-6-2-3-7-20(19)17-24(22)36-13-5-4-10-31-11-14-35-15-12-31/h2-3,6-9,16-18,30H,4-5,10-15H2,1H3,(H,28,29,32) |
| InChIKey | ZZPCWEBZSWSSQJ-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 109.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.69 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|