C10H11OY+2 — CID 20627858
2-methyl-2,3,4,6-tetrahydrochromen-6-ide;yttrium(3+) (PubChem CID 20627858) has the molecular formula C10H11OY+2 and a molecular weight of 236.10 g/mol. Its IUPAC name is 2-methyl-2,3,4,6-tetrahydrochromen-6-ide;yttrium(3+).
| Compound Name | 2-methyl-2,3,4,6-tetrahydrochromen-6-ide;yttrium(3+) |
|---|---|
| PubChem CID | 20627858 |
| Molecular Formula | C10H11OY+2 |
| Molecular Weight | 236.10 g/mol |
| Exact Mass | 235.99 |
| IUPAC Name | 2-methyl-2,3,4,6-tetrahydrochromen-6-ide;yttrium(3+) |
| SMILES | CC1CCc2c[c-]ccc2O1.[Y+3] |
| InChI | InChI=1S/C10H11O.Y/c1-8-6-7-9-4-2-3-5-10(9)11-8;/h3-5,8H,6-7H2,1H3;/q-1;+3 |
| InChIKey | ROFHPJIHSYCSSM-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.10 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|