C12H18BrNO — CID 115250747
2-[[(4-bromophenyl)methylamino]methyl]butan-1-ol (PubChem CID 115250747) has the molecular formula C12H18BrNO and a molecular weight of 272.19 g/mol. Its IUPAC name is 2-[[(4-bromophenyl)methylamino]methyl]butan-1-ol.
| Compound Name | 2-[[(4-bromophenyl)methylamino]methyl]butan-1-ol |
|---|---|
| PubChem CID | 115250747 |
| Molecular Formula | C12H18BrNO |
| Molecular Weight | 272.19 g/mol |
| Exact Mass | 271.06 |
| IUPAC Name | 2-[[(4-bromophenyl)methylamino]methyl]butan-1-ol |
| SMILES | CCC(CO)CNCc1ccc(Br)cc1 |
| InChI | InChI=1S/C12H18BrNO/c1-2-10(9-15)7-14-8-11-3-5-12(13)6-4-11/h3-6,10,14-15H,2,7-9H2,1H3 |
| InChIKey | LVSCGGDFRWLELQ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.19 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |