C12H11Cl2N3O3 — CID 169400413
ethyl 5-(3,5-dichloro-2-methoxyphenyl)-2H-triazole-4-carboxylate (PubChem CID 169400413) has the molecular formula C12H11Cl2N3O3 and a molecular weight of 316.14 g/mol. Its IUPAC name is ethyl 5-(3,5-dichloro-2-methoxyphenyl)-2H-triazole-4-carboxylate.
| Compound Name | ethyl 5-(3,5-dichloro-2-methoxyphenyl)-2H-triazole-4-carboxylate |
|---|---|
| PubChem CID | 169400413 |
| Molecular Formula | C12H11Cl2N3O3 |
| Molecular Weight | 316.14 g/mol |
| Exact Mass | 315.02 |
| IUPAC Name | ethyl 5-(3,5-dichloro-2-methoxyphenyl)-2H-triazole-4-carboxylate |
| SMILES | CCOC(=O)c1n[nH]nc1-c1cc(Cl)cc(Cl)c1OC |
| InChI | InChI=1S/C12H11Cl2N3O3/c1-3-20-12(18)10-9(15-17-16-10)7-4-6(13)5-8(14)11(7)19-2/h4-5H,3H2,1-2H3,(H,15,16,17) |
| InChIKey | RCRPEZIOMXTILT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 77.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.14 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |