2-[(5-cyano-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid

C12H8N2O4S2 — CID 19772382

IUPAC2-[(5-cyano-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid
SMILESN#Cc1ccc2sc(SC(CC(=O)O)C(=O)O)nc2c1
InChIInChI=1S/C12H8N2O4S2/c13-5-6-1-2-8-7(3-6)14-12(19-8)20-9(11(17)18)4-10(15)16/h1-3,9H,4H2,(H,15,16)(H,17,18)
InChIKeyHXEBTMBLINCTSD-UHFFFAOYSA-N
MW308.34 g/mol
LogP2.19
Rot. Bonds5

About 2-[(5-cyano-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid

2-[(5-cyano-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid (PubChem CID 19772382) has the molecular formula C12H8N2O4S2 and a molecular weight of 308.34 g/mol. Its IUPAC name is 2-[(5-cyano-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid.

Molecular Properties

Compound Name2-[(5-cyano-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid
PubChem CID19772382
Molecular FormulaC12H8N2O4S2
Molecular Weight308.34 g/mol
Exact Mass307.99
IUPAC Name2-[(5-cyano-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid
SMILESN#Cc1ccc2sc(SC(CC(=O)O)C(=O)O)nc2c1
InChIInChI=1S/C12H8N2O4S2/c13-5-6-1-2-8-7(3-6)14-12(19-8)20-9(11(17)18)4-10(15)16/h1-3,9H,4H2,(H,15,16)(H,17,18)
InChIKeyHXEBTMBLINCTSD-UHFFFAOYSA-N
XLogP2.19
TPSA111.28 Ų
H-Bond Donors2
H-Bond Acceptors6
Rotatable Bonds5
Heavy Atoms20
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500308.34
LogP ≤ 52.19
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 106

Analyze 2-[(5-cyano-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-[(5-cyano-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid?
The IUPAC name of 2-[(5-cyano-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid (CID 19772382) is 2-[(5-cyano-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid.
What is the SMILES notation for 2-[(5-cyano-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid?
The canonical SMILES for 2-[(5-cyano-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid is N#Cc1ccc2sc(SC(CC(=O)O)C(=O)O)nc2c1.
What is the InChIKey of 2-[(5-cyano-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid?
The InChIKey is HXEBTMBLINCTSD-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H8N2O4S2/c13-5-6-1-2-8-7(3-6)14-12(19-8)20-9(11(17)18)4-10(15)16/h1-3,9H,4H2,(H,15,16)(H,17,18).
What are the key properties of 2-[(5-cyano-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid?
2-[(5-cyano-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid has a molecular weight of 308.34 g/mol, XLogP of 2.19, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[(5-cyano-1,3-benzothiazol-2-yl)sulfanyl]butanedioic acid is sourced from PubChem (CID 19772382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).