C19H27N3O3S — CID 47040772
morpholin-4-yl-[1-(2-propan-2-ylsulfanylpyridine-3-carbonyl)piperidin-3-yl]methanone (PubChem CID 47040772) has the molecular formula C19H27N3O3S and a molecular weight of 377.51 g/mol. Its IUPAC name is morpholin-4-yl-[1-(2-propan-2-ylsulfanylpyridine-3-carbonyl)piperidin-3-yl]methanone.
| Compound Name | morpholin-4-yl-[1-(2-propan-2-ylsulfanylpyridine-3-carbonyl)piperidin-3-yl]methanone |
|---|---|
| PubChem CID | 47040772 |
| Molecular Formula | C19H27N3O3S |
| Molecular Weight | 377.51 g/mol |
| Exact Mass | 377.18 |
| IUPAC Name | morpholin-4-yl-[1-(2-propan-2-ylsulfanylpyridine-3-carbonyl)piperidin-3-yl]methanone |
| SMILES | CC(C)Sc1ncccc1C(=O)N1CCCC(C(=O)N2CCOCC2)C1 |
| InChI | InChI=1S/C19H27N3O3S/c1-14(2)26-17-16(6-3-7-20-17)19(24)22-8-4-5-15(13-22)18(23)21-9-11-25-12-10-21/h3,6-7,14-15H,4-5,8-13H2,1-2H3 |
| InChIKey | JPKRHXZMCOULSM-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 62.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.51 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |