C14H18N2O3S — CID 78919070
methyl 1-(2-methylsulfanylpyridine-3-carbonyl)piperidine-3-carboxylate (PubChem CID 78919070) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is methyl 1-(2-methylsulfanylpyridine-3-carbonyl)piperidine-3-carboxylate.
| Compound Name | methyl 1-(2-methylsulfanylpyridine-3-carbonyl)piperidine-3-carboxylate |
|---|---|
| PubChem CID | 78919070 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | methyl 1-(2-methylsulfanylpyridine-3-carbonyl)piperidine-3-carboxylate |
| SMILES | COC(=O)C1CCCN(C(=O)c2cccnc2SC)C1 |
| InChI | InChI=1S/C14H18N2O3S/c1-19-14(18)10-5-4-8-16(9-10)13(17)11-6-3-7-15-12(11)20-2/h3,6-7,10H,4-5,8-9H2,1-2H3 |
| InChIKey | HGZGNUUUSWCZES-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |