C12H13F2NO4S — CID 55479792
(2-oxo-2-propan-2-yloxyethyl) 2-(difluoromethylsulfanyl)pyridine-3-carboxylate (PubChem CID 55479792) has the molecular formula C12H13F2NO4S and a molecular weight of 305.30 g/mol. Its IUPAC name is (2-oxo-2-propan-2-yloxyethyl) 2-(difluoromethylsulfanyl)pyridine-3-carboxylate.
| Compound Name | (2-oxo-2-propan-2-yloxyethyl) 2-(difluoromethylsulfanyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 55479792 |
| Molecular Formula | C12H13F2NO4S |
| Molecular Weight | 305.30 g/mol |
| Exact Mass | 305.05 |
| IUPAC Name | (2-oxo-2-propan-2-yloxyethyl) 2-(difluoromethylsulfanyl)pyridine-3-carboxylate |
| SMILES | CC(C)OC(=O)COC(=O)c1cccnc1SC(F)F |
| InChI | InChI=1S/C12H13F2NO4S/c1-7(2)19-9(16)6-18-11(17)8-4-3-5-15-10(8)20-12(13)14/h3-5,7,12H,6H2,1-2H3 |
| InChIKey | DRFXPLVMUBTKEC-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 65.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |