C16H15F2NO2S — CID 55381287
3-phenylpropyl 2-(difluoromethylsulfanyl)pyridine-3-carboxylate (PubChem CID 55381287) has the molecular formula C16H15F2NO2S and a molecular weight of 323.36 g/mol. Its IUPAC name is 3-phenylpropyl 2-(difluoromethylsulfanyl)pyridine-3-carboxylate.
| Compound Name | 3-phenylpropyl 2-(difluoromethylsulfanyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 55381287 |
| Molecular Formula | C16H15F2NO2S |
| Molecular Weight | 323.36 g/mol |
| Exact Mass | 323.08 |
| IUPAC Name | 3-phenylpropyl 2-(difluoromethylsulfanyl)pyridine-3-carboxylate |
| SMILES | O=C(OCCCc1ccccc1)c1cccnc1SC(F)F |
| InChI | InChI=1S/C16H15F2NO2S/c17-16(18)22-14-13(9-4-10-19-14)15(20)21-11-5-8-12-6-2-1-3-7-12/h1-4,6-7,9-10,16H,5,8,11H2 |
| InChIKey | WKYYVGDNOCPXBJ-UHFFFAOYSA-N |
| XLogP | 4.19 |
| TPSA | 39.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.36 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|