C18H13F3N2O4S — CID 33226222
2-(1,3-dioxoisoindol-2-yl)ethyl 2-(2,2,2-trifluoroethylsulfanyl)pyridine-3-carboxylate (PubChem CID 33226222) has the molecular formula C18H13F3N2O4S and a molecular weight of 410.37 g/mol. Its IUPAC name is 2-(1,3-dioxoisoindol-2-yl)ethyl 2-(2,2,2-trifluoroethylsulfanyl)pyridine-3-carboxylate.
| Compound Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-(2,2,2-trifluoroethylsulfanyl)pyridine-3-carboxylate |
|---|---|
| PubChem CID | 33226222 |
| Molecular Formula | C18H13F3N2O4S |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.05 |
| IUPAC Name | 2-(1,3-dioxoisoindol-2-yl)ethyl 2-(2,2,2-trifluoroethylsulfanyl)pyridine-3-carboxylate |
| SMILES | O=C(OCCN1C(=O)c2ccccc2C1=O)c1cccnc1SCC(F)(F)F |
| InChI | InChI=1S/C18H13F3N2O4S/c19-18(20,21)10-28-14-13(6-3-7-22-14)17(26)27-9-8-23-15(24)11-4-1-2-5-12(11)16(23)25/h1-7H,8-10H2 |
| InChIKey | ZYUBGFILZQCIHM-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 76.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|