C22H25NO6 — CID 7568295
methyl 4-[[(2S)-2-[(4-methoxybenzoyl)amino]-3-methylbutanoyl]oxymethyl]benzoate (PubChem CID 7568295) has the molecular formula C22H25NO6 and a molecular weight of 399.44 g/mol. Its IUPAC name is methyl 4-[[(2S)-2-[(4-methoxybenzoyl)amino]-3-methylbutanoyl]oxymethyl]benzoate.
| Compound Name | methyl 4-[[(2S)-2-[(4-methoxybenzoyl)amino]-3-methylbutanoyl]oxymethyl]benzoate |
|---|---|
| PubChem CID | 7568295 |
| Molecular Formula | C22H25NO6 |
| Molecular Weight | 399.44 g/mol |
| Exact Mass | 399.17 |
| IUPAC Name | methyl 4-[[(2S)-2-[(4-methoxybenzoyl)amino]-3-methylbutanoyl]oxymethyl]benzoate |
| SMILES | COC(=O)c1ccc(COC(=O)[C@@H](NC(=O)c2ccc(OC)cc2)C(C)C)cc1 |
| InChI | InChI=1S/C22H25NO6/c1-14(2)19(23-20(24)16-9-11-18(27-3)12-10-16)22(26)29-13-15-5-7-17(8-6-15)21(25)28-4/h5-12,14,19H,13H2,1-4H3,(H,23,24)/t19-/m0/s1 |
| InChIKey | CBPUFCDYEPNLCG-IBGZPJMESA-N |
| XLogP | 2.98 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.44 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |