C23H27NO6 — CID 7568431
(5-acetyl-2-methoxyphenyl)methyl (2S)-2-[(4-methoxybenzoyl)amino]-3-methylbutanoate (PubChem CID 7568431) has the molecular formula C23H27NO6 and a molecular weight of 413.47 g/mol. Its IUPAC name is (5-acetyl-2-methoxyphenyl)methyl (2S)-2-[(4-methoxybenzoyl)amino]-3-methylbutanoate.
| Compound Name | (5-acetyl-2-methoxyphenyl)methyl (2S)-2-[(4-methoxybenzoyl)amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 7568431 |
| Molecular Formula | C23H27NO6 |
| Molecular Weight | 413.47 g/mol |
| Exact Mass | 413.18 |
| IUPAC Name | (5-acetyl-2-methoxyphenyl)methyl (2S)-2-[(4-methoxybenzoyl)amino]-3-methylbutanoate |
| SMILES | COc1ccc(C(=O)N[C@H](C(=O)OCc2cc(C(C)=O)ccc2OC)C(C)C)cc1 |
| InChI | InChI=1S/C23H27NO6/c1-14(2)21(24-22(26)16-6-9-19(28-4)10-7-16)23(27)30-13-18-12-17(15(3)25)8-11-20(18)29-5/h6-12,14,21H,13H2,1-5H3,(H,24,26)/t21-/m0/s1 |
| InChIKey | DSPJSHRCHJLAAI-NRFANRHFSA-N |
| XLogP | 3.40 |
| TPSA | 90.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.47 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |