C18H25N3O5 — CID 8885264
[2-(tert-butylcarbamoylamino)-2-oxoethyl] (2S)-2-[(3-methylbenzoyl)amino]propanoate (PubChem CID 8885264) has the molecular formula C18H25N3O5 and a molecular weight of 363.41 g/mol. Its IUPAC name is [2-(tert-butylcarbamoylamino)-2-oxoethyl] (2S)-2-[(3-methylbenzoyl)amino]propanoate.
| Compound Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] (2S)-2-[(3-methylbenzoyl)amino]propanoate |
|---|---|
| PubChem CID | 8885264 |
| Molecular Formula | C18H25N3O5 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.18 |
| IUPAC Name | [2-(tert-butylcarbamoylamino)-2-oxoethyl] (2S)-2-[(3-methylbenzoyl)amino]propanoate |
| SMILES | Cc1cccc(C(=O)N[C@@H](C)C(=O)OCC(=O)NC(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C18H25N3O5/c1-11-7-6-8-13(9-11)15(23)19-12(2)16(24)26-10-14(22)20-17(25)21-18(3,4)5/h6-9,12H,10H2,1-5H3,(H,19,23)(H2,20,21,22,25)/t12-/m0/s1 |
| InChIKey | XRDVNWDUOZIRCR-LBPRGKRZSA-N |
| XLogP | 1.28 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |