C24H27NO3 — CID 16564461
[2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethyl] 3,3-diphenylpropanoate (PubChem CID 16564461) has the molecular formula C24H27NO3 and a molecular weight of 377.48 g/mol. Its IUPAC name is [2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethyl] 3,3-diphenylpropanoate.
| Compound Name | [2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethyl] 3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 16564461 |
| Molecular Formula | C24H27NO3 |
| Molecular Weight | 377.48 g/mol |
| Exact Mass | 377.20 |
| IUPAC Name | [2-(3-ethylpent-1-yn-3-ylamino)-2-oxoethyl] 3,3-diphenylpropanoate |
| SMILES | C#CC(CC)(CC)NC(=O)COC(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H27NO3/c1-4-24(5-2,6-3)25-22(26)18-28-23(27)17-21(19-13-9-7-10-14-19)20-15-11-8-12-16-20/h1,7-16,21H,5-6,17-18H2,2-3H3,(H,25,26) |
| InChIKey | OZIDDPLYMAJYJI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.48 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|