C24H23NO6 — CID 7228533
[2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate (PubChem CID 7228533) has the molecular formula C24H23NO6 and a molecular weight of 421.45 g/mol. Its IUPAC name is [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate.
| Compound Name | [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 7228533 |
| Molecular Formula | C24H23NO6 |
| Molecular Weight | 421.45 g/mol |
| Exact Mass | 421.15 |
| IUPAC Name | [2-[4-(3-methylbutanoylamino)phenyl]-2-oxoethyl] 1,4-dihydroxynaphthalene-2-carboxylate |
| SMILES | CC(C)CC(=O)Nc1ccc(C(=O)COC(=O)c2cc(O)c3ccccc3c2O)cc1 |
| InChI | InChI=1S/C24H23NO6/c1-14(2)11-22(28)25-16-9-7-15(8-10-16)21(27)13-31-24(30)19-12-20(26)17-5-3-4-6-18(17)23(19)29/h3-10,12,14,26,29H,11,13H2,1-2H3,(H,25,28) |
| InChIKey | OSHHHLSTFJHDPX-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 112.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.45 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|