C14H11Cl2N3O2 — CID 9068732
4-chloro-N-[2-(4-chloroanilino)-2-oxoethyl]pyridine-2-carboxamide (PubChem CID 9068732) has the molecular formula C14H11Cl2N3O2 and a molecular weight of 324.17 g/mol. Its IUPAC name is 4-chloro-N-[2-(4-chloroanilino)-2-oxoethyl]pyridine-2-carboxamide.
| Compound Name | 4-chloro-N-[2-(4-chloroanilino)-2-oxoethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 9068732 |
| Molecular Formula | C14H11Cl2N3O2 |
| Molecular Weight | 324.17 g/mol |
| Exact Mass | 323.02 |
| IUPAC Name | 4-chloro-N-[2-(4-chloroanilino)-2-oxoethyl]pyridine-2-carboxamide |
| SMILES | O=C(CNC(=O)c1cc(Cl)ccn1)Nc1ccc(Cl)cc1 |
| InChI | InChI=1S/C14H11Cl2N3O2/c15-9-1-3-11(4-2-9)19-13(20)8-18-14(21)12-7-10(16)5-6-17-12/h1-7H,8H2,(H,18,21)(H,19,20) |
| InChIKey | PACZCTCLBCBYKW-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 71.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.17 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |