C16H17ClN4O4S — CID 9479430
4-chloro-N-[2-[4-methyl-3-(methylsulfamoyl)anilino]-2-oxoethyl]pyridine-2-carboxamide (PubChem CID 9479430) has the molecular formula C16H17ClN4O4S and a molecular weight of 396.86 g/mol. Its IUPAC name is 4-chloro-N-[2-[4-methyl-3-(methylsulfamoyl)anilino]-2-oxoethyl]pyridine-2-carboxamide.
| Compound Name | 4-chloro-N-[2-[4-methyl-3-(methylsulfamoyl)anilino]-2-oxoethyl]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 9479430 |
| Molecular Formula | C16H17ClN4O4S |
| Molecular Weight | 396.86 g/mol |
| Exact Mass | 396.07 |
| IUPAC Name | 4-chloro-N-[2-[4-methyl-3-(methylsulfamoyl)anilino]-2-oxoethyl]pyridine-2-carboxamide |
| SMILES | CNS(=O)(=O)c1cc(NC(=O)CNC(=O)c2cc(Cl)ccn2)ccc1C |
| InChI | InChI=1S/C16H17ClN4O4S/c1-10-3-4-12(8-14(10)26(24,25)18-2)21-15(22)9-20-16(23)13-7-11(17)5-6-19-13/h3-8,18H,9H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | HDSALJINIXDKQM-UHFFFAOYSA-N |
| XLogP | 1.32 |
| TPSA | 117.26 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.86 |
| LogP ≤ 5 | 1.32 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |