C17H16ClN3O4 — CID 9378201
methyl 3-[[2-[(4-chloropyridine-2-carbonyl)amino]acetyl]amino]-4-methylbenzoate (PubChem CID 9378201) has the molecular formula C17H16ClN3O4 and a molecular weight of 361.79 g/mol. Its IUPAC name is methyl 3-[[2-[(4-chloropyridine-2-carbonyl)amino]acetyl]amino]-4-methylbenzoate.
| Compound Name | methyl 3-[[2-[(4-chloropyridine-2-carbonyl)amino]acetyl]amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 9378201 |
| Molecular Formula | C17H16ClN3O4 |
| Molecular Weight | 361.79 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | methyl 3-[[2-[(4-chloropyridine-2-carbonyl)amino]acetyl]amino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)CNC(=O)c2cc(Cl)ccn2)c1 |
| InChI | InChI=1S/C17H16ClN3O4/c1-10-3-4-11(17(24)25-2)7-13(10)21-15(22)9-20-16(23)14-8-12(18)5-6-19-14/h3-8H,9H2,1-2H3,(H,20,23)(H,21,22) |
| InChIKey | VJJRUDPJNAAURL-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.79 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |