C17H16ClNO4S — CID 7238274
[2-(2-methylanilino)-2-oxoethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate (PubChem CID 7238274) has the molecular formula C17H16ClNO4S and a molecular weight of 365.84 g/mol. Its IUPAC name is [2-(2-methylanilino)-2-oxoethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate.
| Compound Name | [2-(2-methylanilino)-2-oxoethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7238274 |
| Molecular Formula | C17H16ClNO4S |
| Molecular Weight | 365.84 g/mol |
| Exact Mass | 365.05 |
| IUPAC Name | [2-(2-methylanilino)-2-oxoethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate |
| SMILES | Cc1ccccc1NC(=O)COC(=O)CCC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C17H16ClNO4S/c1-11-4-2-3-5-12(11)19-16(21)10-23-17(22)9-6-13(20)14-7-8-15(18)24-14/h2-5,7-8H,6,9-10H2,1H3,(H,19,21) |
| InChIKey | CUJVORARLFPETQ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.84 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |