C17H16ClNO4S2 — CID 7618205
[2-(2-methylsulfanylanilino)-2-oxoethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate (PubChem CID 7618205) has the molecular formula C17H16ClNO4S2 and a molecular weight of 397.91 g/mol. Its IUPAC name is [2-(2-methylsulfanylanilino)-2-oxoethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate.
| Compound Name | [2-(2-methylsulfanylanilino)-2-oxoethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7618205 |
| Molecular Formula | C17H16ClNO4S2 |
| Molecular Weight | 397.91 g/mol |
| Exact Mass | 397.02 |
| IUPAC Name | [2-(2-methylsulfanylanilino)-2-oxoethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate |
| SMILES | CSc1ccccc1NC(=O)COC(=O)CCC(=O)c1ccc(Cl)s1 |
| InChI | InChI=1S/C17H16ClNO4S2/c1-24-13-5-3-2-4-11(13)19-16(21)10-23-17(22)9-6-12(20)14-7-8-15(18)25-14/h2-5,7-8H,6,9-10H2,1H3,(H,19,21) |
| InChIKey | SWSRNZMAWXIJTR-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.91 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |