C18H16ClNO5S — CID 7238256
[2-(3-acetylanilino)-2-oxoethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate (PubChem CID 7238256) has the molecular formula C18H16ClNO5S and a molecular weight of 393.85 g/mol. Its IUPAC name is [2-(3-acetylanilino)-2-oxoethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate.
| Compound Name | [2-(3-acetylanilino)-2-oxoethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7238256 |
| Molecular Formula | C18H16ClNO5S |
| Molecular Weight | 393.85 g/mol |
| Exact Mass | 393.04 |
| IUPAC Name | [2-(3-acetylanilino)-2-oxoethyl] 4-(5-chlorothiophen-2-yl)-4-oxobutanoate |
| SMILES | CC(=O)c1cccc(NC(=O)COC(=O)CCC(=O)c2ccc(Cl)s2)c1 |
| InChI | InChI=1S/C18H16ClNO5S/c1-11(21)12-3-2-4-13(9-12)20-17(23)10-25-18(24)8-5-14(22)15-6-7-16(19)26-15/h2-4,6-7,9H,5,8,10H2,1H3,(H,20,23) |
| InChIKey | RBSHWODMESRIHJ-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.85 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |